C28H33ClN2O3S — CID 23401883
4-chloro-N-[[2-[3-(cyclohexylamino)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide (PubChem CID 23401883) has the molecular formula C28H33ClN2O3S and a molecular weight of 513.10 g/mol. Its IUPAC name is 4-chloro-N-[[2-[3-(cyclohexylamino)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[[2-[3-(cyclohexylamino)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 23401883 |
| Molecular Formula | C28H33ClN2O3S |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-chloro-N-[[2-[3-(cyclohexylamino)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccccc1OCCCNC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H33ClN2O3S/c29-24-16-18-27(19-17-24)35(32,33)31(26-13-5-2-6-14-26)22-23-10-7-8-15-28(23)34-21-9-20-30-25-11-3-1-4-12-25/h2,5-8,10,13-19,25,30H,1,3-4,9,11-12,20-22H2 |
| InChIKey | GIBYKXLSZJNDOS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|