C31H36ClN3O4S — CID 100525361
(2S)-2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100525361) has the molecular formula C31H36ClN3O4S and a molecular weight of 582.17 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100525361 |
| Molecular Formula | C31H36ClN3O4S |
| Molecular Weight | 582.17 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (2S)-2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H36ClN3O4S/c1-2-29(31(37)33-26-14-8-4-9-15-26)34(22-24-12-6-3-7-13-24)30(36)23-35(27-16-10-5-11-17-27)40(38,39)28-20-18-25(32)19-21-28/h3,5-7,10-13,16-21,26,29H,2,4,8-9,14-15,22-23H2,1H3,(H,33,37)/t29-/m0/s1 |
| InChIKey | DPNVPABFJOBARM-LJAQVGFWSA-N |
| XLogP | 5.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |