C30H34ClN3O4S — CID 132629847
2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclopentylbutanamide (PubChem CID 132629847) has the molecular formula C30H34ClN3O4S and a molecular weight of 568.14 g/mol. Its IUPAC name is 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132629847 |
| Molecular Formula | C30H34ClN3O4S |
| Molecular Weight | 568.14 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2-[benzyl-[2-(N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34ClN3O4S/c1-2-28(30(36)32-25-13-9-10-14-25)33(21-23-11-5-3-6-12-23)29(35)22-34(26-15-7-4-8-16-26)39(37,38)27-19-17-24(31)18-20-27/h3-8,11-12,15-20,25,28H,2,9-10,13-14,21-22H2,1H3,(H,32,36) |
| InChIKey | VRZBCPLFUURUJV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.14 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |