C26H29ClN2O3S — CID 22275720
4-chloro-N-phenyl-N-[[2-(2-piperidin-2-ylethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 22275720) has the molecular formula C26H29ClN2O3S and a molecular weight of 485.05 g/mol. Its IUPAC name is 4-chloro-N-phenyl-N-[[2-(2-piperidin-2-ylethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-phenyl-N-[[2-(2-piperidin-2-ylethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22275720 |
| Molecular Formula | C26H29ClN2O3S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 4-chloro-N-phenyl-N-[[2-(2-piperidin-2-ylethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccccc1OCCC1CCCCN1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN2O3S/c27-22-13-15-25(16-14-22)33(30,31)29(24-10-2-1-3-11-24)20-21-8-4-5-12-26(21)32-19-17-23-9-6-7-18-28-23/h1-5,8,10-16,23,28H,6-7,9,17-20H2 |
| InChIKey | CVSVONBPWABIBG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |