C29H32Cl2N2O3S — CID 22276133
(E)-N-(2,5-dichlorophenyl)-2-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]ethenesulfonamide (PubChem CID 22276133) has the molecular formula C29H32Cl2N2O3S and a molecular weight of 559.56 g/mol. Its IUPAC name is (E)-N-(2,5-dichlorophenyl)-2-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]ethenesulfonamide.
| Compound Name | (E)-N-(2,5-dichlorophenyl)-2-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 22276133 |
| Molecular Formula | C29H32Cl2N2O3S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (E)-N-(2,5-dichlorophenyl)-2-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N(Cc1ccccc1OCCCN1CCCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C29H32Cl2N2O3S/c30-26-14-15-27(31)28(22-26)33(37(34,35)21-16-24-10-3-1-4-11-24)23-25-12-5-6-13-29(25)36-20-9-19-32-17-7-2-8-18-32/h1,3-6,10-16,21-22H,2,7-9,17-20,23H2/b21-16+ |
| InChIKey | WUXSMPHEWQJZQO-LTGZKZEYSA-N |
| XLogP | 7.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|