C15H21ClN2O2 — CID 69457869
4-[4-(4-chlorophenyl)butyl]piperazine-1-carboxylic acid (PubChem CID 69457869) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)butyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(4-chlorophenyl)butyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69457869 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[4-(4-chlorophenyl)butyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(CCCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H21ClN2O2/c16-14-6-4-13(5-7-14)3-1-2-8-17-9-11-18(12-10-17)15(19)20/h4-7H,1-3,8-12H2,(H,19,20) |
| InChIKey | HPFUMAUBYDOZMP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|