C30H34FNO4 — CID 69236553
[2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)ethyl] acetate (PubChem CID 69236553) has the molecular formula C30H34FNO4 and a molecular weight of 491.60 g/mol. Its IUPAC name is [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)ethyl] acetate.
| Compound Name | [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)ethyl] acetate |
|---|---|
| PubChem CID | 69236553 |
| Molecular Formula | C30H34FNO4 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)ethyl] acetate |
| SMILES | CC(=O)OC(CN1CCC(CCOC(c2ccccc2)c2ccccc2)C(O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H34FNO4/c1-22(33)36-29(24-12-14-27(31)15-13-24)21-32-18-16-23(28(34)20-32)17-19-35-30(25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-15,23,28-30,34H,16-21H2,1H3 |
| InChIKey | QIYXHUMJJPQSFH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |