C33H38F2N2O9 — CID 11650366
(2S)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3-phenylpropan-2-amine;oxalic acid (PubChem CID 11650366) has the molecular formula C33H38F2N2O9 and a molecular weight of 644.67 g/mol. Its IUPAC name is (2S)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3-phenylpropan-2-amine;oxalic acid.
| Compound Name | (2S)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3-phenylpropan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 11650366 |
| Molecular Formula | C33H38F2N2O9 |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | (2S)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3-phenylpropan-2-amine;oxalic acid |
| SMILES | N[C@@H](Cc1ccccc1)CN1CCC(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H34F2N2O.2C2H2O4/c30-26-10-6-24(7-11-26)29(25-8-12-27(31)13-9-25)34-19-16-22-14-17-33(18-15-22)21-28(32)20-23-4-2-1-3-5-23;2*3-1(4)2(5)6/h1-13,22,28-29H,14-21,32H2;2*(H,3,4)(H,5,6)/t28-;;/m0../s1 |
| InChIKey | XQOCAAJLFFVLEP-ZXVJYWQYSA-N |
| XLogP | 4.05 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|