C30H35NO4 — CID 69229771
[2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-phenylethyl] acetate (PubChem CID 69229771) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-phenylethyl] acetate.
| Compound Name | [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 69229771 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [2-[4-(2-benzhydryloxyethyl)-3-hydroxypiperidin-1-yl]-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(CN1CCC(CCOC(c2ccccc2)c2ccccc2)C(O)C1)c1ccccc1 |
| InChI | InChI=1S/C30H35NO4/c1-23(32)35-29(25-11-5-2-6-12-25)22-31-19-17-24(28(33)21-31)18-20-34-30(26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,24,28-30,33H,17-22H2,1H3 |
| InChIKey | WLVOFCZKCYOMCY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |