C22H23F2NO2 — CID 161033238
bis(3-fluorophenyl)methyl 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]acetate (PubChem CID 161033238) has the molecular formula C22H23F2NO2 and a molecular weight of 371.43 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]acetate.
| Compound Name | bis(3-fluorophenyl)methyl 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]acetate |
|---|---|
| PubChem CID | 161033238 |
| Molecular Formula | C22H23F2NO2 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | bis(3-fluorophenyl)methyl 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]acetate |
| SMILES | O=C(C[C@H]1CN2CCC1CC2)OC(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H23F2NO2/c23-19-5-1-3-16(11-19)22(17-4-2-6-20(24)12-17)27-21(26)13-18-14-25-9-7-15(18)8-10-25/h1-6,11-12,15,18,22H,7-10,13-14H2/t18-/m0/s1 |
| InChIKey | TZXDWOVNCXMTJA-SFHVURJKSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |