C21H23FN2O2 — CID 91550212
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(N-(3-fluorophenyl)anilino)acetate (PubChem CID 91550212) has the molecular formula C21H23FN2O2 and a molecular weight of 354.42 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(N-(3-fluorophenyl)anilino)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(N-(3-fluorophenyl)anilino)acetate |
|---|---|
| PubChem CID | 91550212 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(N-(3-fluorophenyl)anilino)acetate |
| SMILES | O=C(CN(c1ccccc1)c1cccc(F)c1)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C21H23FN2O2/c22-17-5-4-8-19(13-17)24(18-6-2-1-3-7-18)15-21(25)26-20-14-23-11-9-16(20)10-12-23/h1-8,13,16,20H,9-12,14-15H2/t20-/m0/s1 |
| InChIKey | DQWFIOBOUGQCFY-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |