C21H23BrN2O2 — CID 10158758
1-azabicyclo[2.2.2]octan-3-yl N-benzyl-N-(3-bromophenyl)carbamate (PubChem CID 10158758) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-benzyl-N-(3-bromophenyl)carbamate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-benzyl-N-(3-bromophenyl)carbamate |
|---|---|
| PubChem CID | 10158758 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-benzyl-N-(3-bromophenyl)carbamate |
| SMILES | O=C(OC1CN2CCC1CC2)N(Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H23BrN2O2/c22-18-7-4-8-19(13-18)24(14-16-5-2-1-3-6-16)21(25)26-20-15-23-11-9-17(20)10-12-23/h1-8,13,17,20H,9-12,14-15H2 |
| InChIKey | CECPVWRBSVBVBV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |