C15H18BrNO3 — CID 59187157
1-azabicyclo[2.2.2]octan-3-yl (3-bromophenyl)methyl carbonate (PubChem CID 59187157) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl (3-bromophenyl)methyl carbonate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl (3-bromophenyl)methyl carbonate |
|---|---|
| PubChem CID | 59187157 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl (3-bromophenyl)methyl carbonate |
| SMILES | O=C(OCc1cccc(Br)c1)OC1CN2CCC1CC2 |
| InChI | InChI=1S/C15H18BrNO3/c16-13-3-1-2-11(8-13)10-19-15(18)20-14-9-17-6-4-12(14)5-7-17/h1-3,8,12,14H,4-7,9-10H2 |
| InChIKey | SSDFKFNINOCBQC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |