C19H24BrNO2 — CID 118981088
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-(3-bromophenyl)cyclopentane-1-carboxylate (PubChem CID 118981088) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-(3-bromophenyl)cyclopentane-1-carboxylate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-(3-bromophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 118981088 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-(3-bromophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)C1(c2cccc(Br)c2)CCCC1 |
| InChI | InChI=1S/C19H24BrNO2/c20-16-5-3-4-15(12-16)19(8-1-2-9-19)18(22)23-17-13-21-10-6-14(17)7-11-21/h3-5,12,14,17H,1-2,6-11,13H2/t17-/m0/s1 |
| InChIKey | ARXBAWMWPLXBDK-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |