C24H36N2O2 — CID 118981331
1-azabicyclo[2.2.2]octan-3-yl 1-[3-(4-aminobutyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 118981331) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(4-aminobutyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(4-aminobutyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118981331 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(4-aminobutyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | NCCCCc1cccc(C2(C(=O)OC3CN4CCC3CC4)CCCCC2)c1 |
| InChI | InChI=1S/C24H36N2O2/c25-14-5-2-7-19-8-6-9-21(17-19)24(12-3-1-4-13-24)23(27)28-22-18-26-15-10-20(22)11-16-26/h6,8-9,17,20,22H,1-5,7,10-16,18,25H2 |
| InChIKey | MDYNQNNKSXOTDK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|