C36H52N2O5Si — CID 140811233
3-[3-[1-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl]cyclohexyl]phenyl]propyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carboxylate (PubChem CID 140811233) has the molecular formula C36H52N2O5Si and a molecular weight of 620.91 g/mol. Its IUPAC name is 3-[3-[1-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl]cyclohexyl]phenyl]propyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carboxylate.
| Compound Name | 3-[3-[1-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl]cyclohexyl]phenyl]propyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140811233 |
| Molecular Formula | C36H52N2O5Si |
| Molecular Weight | 620.91 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 3-[3-[1-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl]cyclohexyl]phenyl]propyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(C(=O)OCCCc2cccc(C3(C(=O)O[C@H]4CN5CCC4CC5)CCCCC3)c2)cn1 |
| InChI | InChI=1S/C36H52N2O5Si/c1-35(2,3)44(4,5)42-26-31-15-14-29(24-37-31)33(39)41-22-10-12-27-11-9-13-30(23-27)36(18-7-6-8-19-36)34(40)43-32-25-38-20-16-28(32)17-21-38/h9,11,13-15,23-24,28,32H,6-8,10,12,16-22,25-26H2,1-5H3/t32-/m0/s1 |
| InChIKey | DRNBUNNHQWILSN-YTTGMZPUSA-N |
| XLogP | 7.23 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.91 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|