C25H37NO4 — CID 22310137
bis(4-propylcyclohexyl) pyridine-2,5-dicarboxylate (PubChem CID 22310137) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is bis(4-propylcyclohexyl) pyridine-2,5-dicarboxylate.
| Compound Name | bis(4-propylcyclohexyl) pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 22310137 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | bis(4-propylcyclohexyl) pyridine-2,5-dicarboxylate |
| SMILES | CCCC1CCC(OC(=O)c2ccc(C(=O)OC3CCC(CCC)CC3)nc2)CC1 |
| InChI | InChI=1S/C25H37NO4/c1-3-5-18-7-12-21(13-8-18)29-24(27)20-11-16-23(26-17-20)25(28)30-22-14-9-19(6-4-2)10-15-22/h11,16-19,21-22H,3-10,12-15H2,1-2H3 |
| InChIKey | FVEMICAFXBHELB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |