C23H24N2O3 — CID 18182468
methyl 5-benzyl-6-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]pyridine-3-carboxylate (PubChem CID 18182468) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl 5-benzyl-6-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]pyridine-3-carboxylate.
| Compound Name | methyl 5-benzyl-6-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18182468 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | methyl 5-benzyl-6-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(C#CC2(O)CN3CCC2CC3)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-28-22(26)19-14-18(13-17-5-3-2-4-6-17)21(24-15-19)7-10-23(27)16-25-11-8-20(23)9-12-25/h2-6,14-15,20,27H,8-9,11-13,16H2,1H3 |
| InChIKey | YTBVJKPFAWVTIA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|