methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate

C23H21NO3 — CID 134836490

IUPACmethyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate
SMILESCOC(=O)c1ccc(CC(CC(=O)c2ccccc2)c2ccccc2)nc1
InChIInChI=1S/C23H21NO3/c1-27-23(26)19-12-13-21(24-16-19)14-20(17-8-4-2-5-9-17)15-22(25)18-10-6-3-7-11-18/h2-13,16,20H,14-15H2,1H3
InChIKeyKFTBTSNJSYDXLZ-UHFFFAOYSA-N
MW359.43 g/mol
LogP4.47
Rot. Bonds7

About methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate

methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate (PubChem CID 134836490) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate
PubChem CID134836490
Molecular FormulaC23H21NO3
Molecular Weight359.43 g/mol
Exact Mass359.15
IUPAC Namemethyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate
SMILESCOC(=O)c1ccc(CC(CC(=O)c2ccccc2)c2ccccc2)nc1
InChIInChI=1S/C23H21NO3/c1-27-23(26)19-12-13-21(24-16-19)14-20(17-8-4-2-5-9-17)15-22(25)18-10-6-3-7-11-18/h2-13,16,20H,14-15H2,1H3
InChIKeyKFTBTSNJSYDXLZ-UHFFFAOYSA-N
XLogP4.47
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.43
LogP ≤ 54.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate?
The IUPAC name of methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate (CID 134836490) is methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate is COC(=O)c1ccc(CC(CC(=O)c2ccccc2)c2ccccc2)nc1.
What is the InChIKey of methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate?
The InChIKey is KFTBTSNJSYDXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-27-23(26)19-12-13-21(24-16-19)14-20(17-8-4-2-5-9-17)15-22(25)18-10-6-3-7-11-18/h2-13,16,20H,14-15H2,1H3.
What are the key properties of methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate?
methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate has a molecular weight of 359.43 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate is sourced from PubChem (CID 134836490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).