C23H21NO3 — CID 134836490
methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate (PubChem CID 134836490) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134836490 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | methyl 6-(4-oxo-2,4-diphenylbutyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CC(CC(=O)c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C23H21NO3/c1-27-23(26)19-12-13-21(24-16-19)14-20(17-8-4-2-5-9-17)15-22(25)18-10-6-3-7-11-18/h2-13,16,20H,14-15H2,1H3 |
| InChIKey | KFTBTSNJSYDXLZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |