C21H22N2O2 — CID 25050141
1-azatricyclo[3.3.1.13,7]decan-4-yl 6-phenylpyridine-3-carboxylate (PubChem CID 25050141) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decan-4-yl 6-phenylpyridine-3-carboxylate.
| Compound Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 6-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 25050141 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 6-phenylpyridine-3-carboxylate |
| SMILES | O=C(OC1C2CC3CC1CN(C3)C2)c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C21H22N2O2/c24-21(16-6-7-19(22-10-16)15-4-2-1-3-5-15)25-20-17-8-14-9-18(20)13-23(11-14)12-17/h1-7,10,14,17-18,20H,8-9,11-13H2 |
| InChIKey | PDRVBZVFFXZXTF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |