C34H40N2O4 — CID 130446714
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-[3-[4-(6-formyl-2-oxoquinolin-1-yl)butyl]phenyl]cyclohexane-1-carboxylate (PubChem CID 130446714) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-[3-[4-(6-formyl-2-oxoquinolin-1-yl)butyl]phenyl]cyclohexane-1-carboxylate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-[3-[4-(6-formyl-2-oxoquinolin-1-yl)butyl]phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 130446714 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-[3-[4-(6-formyl-2-oxoquinolin-1-yl)butyl]phenyl]cyclohexane-1-carboxylate |
| SMILES | O=Cc1ccc2c(ccc(=O)n2CCCCc2cccc(C3(C(=O)O[C@H]4CN5CCC4CC5)CCCCC3)c2)c1 |
| InChI | InChI=1S/C34H40N2O4/c37-24-26-10-12-30-28(21-26)11-13-32(38)36(30)18-5-2-7-25-8-6-9-29(22-25)34(16-3-1-4-17-34)33(39)40-31-23-35-19-14-27(31)15-20-35/h6,8-13,21-22,24,27,31H,1-5,7,14-20,23H2/t31-/m0/s1 |
| InChIKey | MOPHOBAFJLLZDJ-HKBQPEDESA-N |
| XLogP | 5.68 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|