C33H41ClN2O6 — CID 118981312
1-azabicyclo[2.2.2]octan-3-yl 1-[3-[3-[[2-(2-chloro-4-formyl-5-methoxyphenoxy)acetyl]amino]propyl]phenyl]cyclohexane-1-carboxylate (PubChem CID 118981312) has the molecular formula C33H41ClN2O6 and a molecular weight of 597.15 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 1-[3-[3-[[2-(2-chloro-4-formyl-5-methoxyphenoxy)acetyl]amino]propyl]phenyl]cyclohexane-1-carboxylate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-[3-[[2-(2-chloro-4-formyl-5-methoxyphenoxy)acetyl]amino]propyl]phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118981312 |
| Molecular Formula | C33H41ClN2O6 |
| Molecular Weight | 597.15 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-[3-[[2-(2-chloro-4-formyl-5-methoxyphenoxy)acetyl]amino]propyl]phenyl]cyclohexane-1-carboxylate |
| SMILES | COc1cc(OCC(=O)NCCCc2cccc(C3(C(=O)OC4CN5CCC4CC5)CCCCC3)c2)c(Cl)cc1C=O |
| InChI | InChI=1S/C33H41ClN2O6/c1-40-28-19-29(27(34)18-25(28)21-37)41-22-31(38)35-14-6-8-23-7-5-9-26(17-23)33(12-3-2-4-13-33)32(39)42-30-20-36-15-10-24(30)11-16-36/h5,7,9,17-19,21,24,30H,2-4,6,8,10-16,20,22H2,1H3,(H,35,38) |
| InChIKey | NSQSTTIOJSSJOP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.15 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|