C23H33NO3 — CID 118981198
1-azabicyclo[2.2.2]octan-3-yl 1-[3-(3-hydroxypropyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 118981198) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(3-hydroxypropyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(3-hydroxypropyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118981198 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 1-[3-(3-hydroxypropyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | O=C(OC1CN2CCC1CC2)C1(c2cccc(CCCO)c2)CCCCC1 |
| InChI | InChI=1S/C23H33NO3/c25-15-5-7-18-6-4-8-20(16-18)23(11-2-1-3-12-23)22(26)27-21-17-24-13-9-19(21)10-14-24/h4,6,8,16,19,21,25H,1-3,5,7,9-15,17H2 |
| InChIKey | ILYKRWPBDDQYGY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |