C19H19BrN2O3 — CID 87668734
[benzyl-(3-bromophenyl)carbamoyl] pyrrolidine-1-carboxylate (PubChem CID 87668734) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is [benzyl-(3-bromophenyl)carbamoyl] pyrrolidine-1-carboxylate.
| Compound Name | [benzyl-(3-bromophenyl)carbamoyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87668734 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [benzyl-(3-bromophenyl)carbamoyl] pyrrolidine-1-carboxylate |
| SMILES | O=C(OC(=O)N(Cc1ccccc1)c1cccc(Br)c1)N1CCCC1 |
| InChI | InChI=1S/C19H19BrN2O3/c20-16-9-6-10-17(13-16)22(14-15-7-2-1-3-8-15)19(24)25-18(23)21-11-4-5-12-21/h1-3,6-10,13H,4-5,11-12,14H2 |
| InChIKey | BOKSGSLXJQWFKU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|