About 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate
1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate (PubChem CID 155565770) has the molecular formula C24H30N2O4
and a molecular weight of 410.51 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate |
| PubChem CID | 155565770 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate |
| SMILES | COc1ccc(CCN(C(=O)OC2CN3CCC2CC3)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H30N2O4/c1-28-21-9-8-18(16-22(21)29-2)10-15-26(20-6-4-3-5-7-20)24(27)30-23-17-25-13-11-19(23)12-14-25/h3-9,16,19,23H,10-15,17H2,1-2H3 |
| InChIKey | GNHXYBDOJNQUSM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate (CID 155565770) is 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate is COc1ccc(CCN(C(=O)OC2CN3CCC2CC3)c2ccccc2)cc1OC.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate?
The InChIKey is GNHXYBDOJNQUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O4/c1-28-21-9-8-18(16-22(21)29-2)10-15-26(20-6-4-3-5-7-20)24(27)30-23-17-25-13-11-19(23)12-14-25/h3-9,16,19,23H,10-15,17H2,1-2H3.
What are the key properties of 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate?
1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate has a molecular weight of 410.51 g/mol, XLogP of 3.98, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-yl N-[2-(3,4-dimethoxyphenyl)ethyl]-N-phenylcarbamate is sourced from PubChem (CID 155565770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).