C25H32N2O4 — CID 155521639
3-(3,4-dimethoxyphenyl)propyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate (PubChem CID 155521639) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)propyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate.
| Compound Name | 3-(3,4-dimethoxyphenyl)propyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate |
|---|---|
| PubChem CID | 155521639 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)propyl N-(1-azabicyclo[2.2.2]octan-3-yl)-N-phenylcarbamate |
| SMILES | COc1ccc(CCCOC(=O)N(c2ccccc2)C2CN3CCC2CC3)cc1OC |
| InChI | InChI=1S/C25H32N2O4/c1-29-23-11-10-19(17-24(23)30-2)7-6-16-31-25(28)27(21-8-4-3-5-9-21)22-18-26-14-12-20(22)13-15-26/h3-5,8-11,17,20,22H,6-7,12-16,18H2,1-2H3 |
| InChIKey | MMSLNHRRTRWHIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|