C23H28N2O3 — CID 118513242
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[5-(3-hydroxypropyl)-2-phenylphenyl]carbamic acid (PubChem CID 118513242) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[5-(3-hydroxypropyl)-2-phenylphenyl]carbamic acid.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[5-(3-hydroxypropyl)-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 118513242 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[5-(3-hydroxypropyl)-2-phenylphenyl]carbamic acid |
| SMILES | O=C(O)N(c1cc(CCCO)ccc1-c1ccccc1)[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C23H28N2O3/c26-14-4-5-17-8-9-20(18-6-2-1-3-7-18)21(15-17)25(23(27)28)22-16-24-12-10-19(22)11-13-24/h1-3,6-9,15,19,22,26H,4-5,10-14,16H2,(H,27,28)/t22-/m0/s1 |
| InChIKey | SKNRUVLGCFXVGS-QFIPXVFZSA-N |
| XLogP | 3.86 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |