About 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate
1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate (PubChem CID 10179406) has the molecular formula C21H22Cl2N2O2
and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate |
| PubChem CID | 10179406 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate |
| SMILES | O=C(OC1CN2CCC1CC2)N(Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c22-18-7-6-15(12-19(18)23)13-25(17-4-2-1-3-5-17)21(26)27-20-14-24-10-8-16(20)9-11-24/h1-7,12,16,20H,8-11,13-14H2 |
| InChIKey | SJYYNVPHTPBMFX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate (CID 10179406) is 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate is O=C(OC1CN2CCC1CC2)N(Cc1ccc(Cl)c(Cl)c1)c1ccccc1.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate?
The InChIKey is SJYYNVPHTPBMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Cl2N2O2/c22-18-7-6-15(12-19(18)23)13-25(17-4-2-1-3-5-17)21(26)27-20-14-24-10-8-16(20)9-11-24/h1-7,12,16,20H,8-11,13-14H2.
What are the key properties of 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate?
1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate has a molecular weight of 405.33 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-yl N-[(3,4-dichlorophenyl)methyl]-N-phenylcarbamate is sourced from PubChem (CID 10179406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).