C21H21F2NO3 — CID 58035471
1-azabicyclo[2.2.2]octan-3-yl [(2-fluorophenyl)-(3-fluorophenyl)methyl] carbonate (PubChem CID 58035471) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl [(2-fluorophenyl)-(3-fluorophenyl)methyl] carbonate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl [(2-fluorophenyl)-(3-fluorophenyl)methyl] carbonate |
|---|---|
| PubChem CID | 58035471 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl [(2-fluorophenyl)-(3-fluorophenyl)methyl] carbonate |
| SMILES | O=C(OC(c1cccc(F)c1)c1ccccc1F)OC1CN2CCC1CC2 |
| InChI | InChI=1S/C21H21F2NO3/c22-16-5-3-4-15(12-16)20(17-6-1-2-7-18(17)23)27-21(25)26-19-13-24-10-8-14(19)9-11-24/h1-7,12,14,19-20H,8-11,13H2 |
| InChIKey | JCRYWOXCSFXCTD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |