C16H21F2NO2 — CID 115529432
ethyl 3-[3-(difluoromethyl)phenyl]-3-pyrrolidin-1-ylpropanoate (PubChem CID 115529432) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl 3-[3-(difluoromethyl)phenyl]-3-pyrrolidin-1-ylpropanoate.
| Compound Name | ethyl 3-[3-(difluoromethyl)phenyl]-3-pyrrolidin-1-ylpropanoate |
|---|---|
| PubChem CID | 115529432 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | ethyl 3-[3-(difluoromethyl)phenyl]-3-pyrrolidin-1-ylpropanoate |
| SMILES | CCOC(=O)CC(c1cccc(C(F)F)c1)N1CCCC1 |
| InChI | InChI=1S/C16H21F2NO2/c1-2-21-15(20)11-14(19-8-3-4-9-19)12-6-5-7-13(10-12)16(17)18/h5-7,10,14,16H,2-4,8-9,11H2,1H3 |
| InChIKey | FDJBAQKSLSKJFR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |