C15H19BrFNO3 — CID 64528413
ethyl 3-(3-bromo-4-fluorophenyl)-3-morpholin-4-ylpropanoate (PubChem CID 64528413) has the molecular formula C15H19BrFNO3 and a molecular weight of 360.22 g/mol. Its IUPAC name is ethyl 3-(3-bromo-4-fluorophenyl)-3-morpholin-4-ylpropanoate.
| Compound Name | ethyl 3-(3-bromo-4-fluorophenyl)-3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 64528413 |
| Molecular Formula | C15H19BrFNO3 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | ethyl 3-(3-bromo-4-fluorophenyl)-3-morpholin-4-ylpropanoate |
| SMILES | CCOC(=O)CC(c1ccc(F)c(Br)c1)N1CCOCC1 |
| InChI | InChI=1S/C15H19BrFNO3/c1-2-21-15(19)10-14(18-5-7-20-8-6-18)11-3-4-13(17)12(16)9-11/h3-4,9,14H,2,5-8,10H2,1H3 |
| InChIKey | YSVQDSRNJDLJNT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |