C18H26FN3O3 — CID 87749330
4-[1-[3-amino-3-(3-fluorophenyl)propanoyl]piperidin-4-yl]-N-hydroxybutanamide (PubChem CID 87749330) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 4-[1-[3-amino-3-(3-fluorophenyl)propanoyl]piperidin-4-yl]-N-hydroxybutanamide.
| Compound Name | 4-[1-[3-amino-3-(3-fluorophenyl)propanoyl]piperidin-4-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87749330 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 4-[1-[3-amino-3-(3-fluorophenyl)propanoyl]piperidin-4-yl]-N-hydroxybutanamide |
| SMILES | NC(CC(=O)N1CCC(CCCC(=O)NO)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H26FN3O3/c19-15-5-2-4-14(11-15)16(20)12-18(24)22-9-7-13(8-10-22)3-1-6-17(23)21-25/h2,4-5,11,13,16,25H,1,3,6-10,12,20H2,(H,21,23) |
| InChIKey | XKQDDNQXJDHLLT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|