C24H32N4O4 — CID 73125115
2-amino-4-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-N-(naphthalen-1-ylmethyl)-4-oxobutanamide (PubChem CID 73125115) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-amino-4-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-N-(naphthalen-1-ylmethyl)-4-oxobutanamide.
| Compound Name | 2-amino-4-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-N-(naphthalen-1-ylmethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 73125115 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-amino-4-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-N-(naphthalen-1-ylmethyl)-4-oxobutanamide |
| SMILES | NC(CC(=O)N1CCC(CCCC(=O)NO)CC1)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H32N4O4/c25-21(24(31)26-16-19-8-4-7-18-6-1-2-9-20(18)19)15-23(30)28-13-11-17(12-14-28)5-3-10-22(29)27-32/h1-2,4,6-9,17,21,32H,3,5,10-16,25H2,(H,26,31)(H,27,29) |
| InChIKey | MLDFZOUNIOWWCC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|