C31H33N3O6S — CID 159529511
N-[2-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-2-oxoethyl]-1-benzothiophene-2-carboxamide;naphthalene-1-carboxylic acid (PubChem CID 159529511) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is N-[2-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-2-oxoethyl]-1-benzothiophene-2-carboxamide;naphthalene-1-carboxylic acid.
| Compound Name | N-[2-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-2-oxoethyl]-1-benzothiophene-2-carboxamide;naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 159529511 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | N-[2-[4-[4-(hydroxyamino)-4-oxobutyl]piperidin-1-yl]-2-oxoethyl]-1-benzothiophene-2-carboxamide;naphthalene-1-carboxylic acid |
| SMILES | O=C(CCCC1CCN(C(=O)CNC(=O)c2cc3ccccc3s2)CC1)NO.O=C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H25N3O4S.C11H8O2/c24-18(22-27)7-3-4-14-8-10-23(11-9-14)19(25)13-21-20(26)17-12-15-5-1-2-6-16(15)28-17;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,5-6,12,14,27H,3-4,7-11,13H2,(H,21,26)(H,22,24);1-7H,(H,12,13) |
| InChIKey | MCUTZXLRASVOFH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|