C16H24N4O3 — CID 91356315
N-(4-aminophenyl)-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide (PubChem CID 91356315) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91356315 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-(4-aminophenyl)-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)N2CCC(CCCC(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C16H24N4O3/c17-13-4-6-14(7-5-13)18-16(22)20-10-8-12(9-11-20)2-1-3-15(21)19-23/h4-7,12,23H,1-3,8-11,17H2,(H,18,22)(H,19,21) |
| InChIKey | LMXCZMYBKFGUTP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|