C22H34N6O3 — CID 91222749
N-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide (PubChem CID 91222749) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide.
| Compound Name | N-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91222749 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | N-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
| SMILES | CN(C)CCCc1nc2ccc(NC(=O)N3CCC(CCCC(=O)NO)CC3)cc2[nH]1 |
| InChI | InChI=1S/C22H34N6O3/c1-27(2)12-4-6-20-24-18-9-8-17(15-19(18)25-20)23-22(30)28-13-10-16(11-14-28)5-3-7-21(29)26-31/h8-9,15-16,31H,3-7,10-14H2,1-2H3,(H,23,30)(H,24,25)(H,26,29) |
| InChIKey | VRDWEPNSDMSXPU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|