C18H26Cl2N4O2 — CID 118075273
7-[6-[bis(2-chloroethyl)amino]-1H-benzimidazol-2-yl]-N-hydroxyheptanamide (PubChem CID 118075273) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 7-[6-[bis(2-chloroethyl)amino]-1H-benzimidazol-2-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[6-[bis(2-chloroethyl)amino]-1H-benzimidazol-2-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118075273 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 7-[6-[bis(2-chloroethyl)amino]-1H-benzimidazol-2-yl]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCc1nc2ccc(N(CCCl)CCCl)cc2[nH]1)NO |
| InChI | InChI=1S/C18H26Cl2N4O2/c19-9-11-24(12-10-20)14-7-8-15-16(13-14)22-17(21-15)5-3-1-2-4-6-18(25)23-26/h7-8,13,26H,1-6,9-12H2,(H,21,22)(H,23,25) |
| InChIKey | MUCHWVHJOFRLRD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|