C12H14N2O3 — CID 81431385
5-(6-hydroxy-1H-benzimidazol-2-yl)pentanoic acid (PubChem CID 81431385) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-(6-hydroxy-1H-benzimidazol-2-yl)pentanoic acid.
| Compound Name | 5-(6-hydroxy-1H-benzimidazol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 81431385 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 5-(6-hydroxy-1H-benzimidazol-2-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2ccc(O)cc2[nH]1 |
| InChI | InChI=1S/C12H14N2O3/c15-8-5-6-9-10(7-8)14-11(13-9)3-1-2-4-12(16)17/h5-7,15H,1-4H2,(H,13,14)(H,16,17) |
| InChIKey | HMSUNDDZSJIFIT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|