C15H14N2O2S — CID 162023239
4-(6-thiophen-2-yl-1H-benzimidazol-2-yl)butanoic acid (PubChem CID 162023239) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-(6-thiophen-2-yl-1H-benzimidazol-2-yl)butanoic acid.
| Compound Name | 4-(6-thiophen-2-yl-1H-benzimidazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 162023239 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-(6-thiophen-2-yl-1H-benzimidazol-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1nc2ccc(-c3cccs3)cc2[nH]1 |
| InChI | InChI=1S/C15H14N2O2S/c18-15(19)5-1-4-14-16-11-7-6-10(9-12(11)17-14)13-3-2-8-20-13/h2-3,6-9H,1,4-5H2,(H,16,17)(H,18,19) |
| InChIKey | XMTDGOMJRMSHIM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |