C12H18N4 — CID 82285613
2-(3-aminopropyl)-N,N-dimethyl-3H-benzimidazol-5-amine (PubChem CID 82285613) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(3-aminopropyl)-N,N-dimethyl-3H-benzimidazol-5-amine.
| Compound Name | 2-(3-aminopropyl)-N,N-dimethyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 82285613 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(3-aminopropyl)-N,N-dimethyl-3H-benzimidazol-5-amine |
| SMILES | CN(C)c1ccc2nc(CCCN)[nH]c2c1 |
| InChI | InChI=1S/C12H18N4/c1-16(2)9-5-6-10-11(8-9)15-12(14-10)4-3-7-13/h5-6,8H,3-4,7,13H2,1-2H3,(H,14,15) |
| InChIKey | GMQVNKMLVQPALX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |