C11H16N4 — CID 82282888
2-(2-aminoethyl)-N,N-dimethyl-3H-benzimidazol-5-amine (PubChem CID 82282888) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N,N-dimethyl-3H-benzimidazol-5-amine.
| Compound Name | 2-(2-aminoethyl)-N,N-dimethyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 82282888 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-(2-aminoethyl)-N,N-dimethyl-3H-benzimidazol-5-amine |
| SMILES | CN(C)c1ccc2nc(CCN)[nH]c2c1 |
| InChI | InChI=1S/C11H16N4/c1-15(2)8-3-4-9-10(7-8)14-11(13-9)5-6-12/h3-4,7H,5-6,12H2,1-2H3,(H,13,14) |
| InChIKey | BCGLSDRIHWSQPE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |