C15H16Cl2FN3 — CID 155971100
2-[6-(2-fluorophenyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride (PubChem CID 155971100) has the molecular formula C15H16Cl2FN3 and a molecular weight of 328.22 g/mol. Its IUPAC name is 2-[6-(2-fluorophenyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride.
| Compound Name | 2-[6-(2-fluorophenyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 155971100 |
| Molecular Formula | C15H16Cl2FN3 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[6-(2-fluorophenyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1nc2ccc(-c3ccccc3F)cc2[nH]1 |
| InChI | InChI=1S/C15H14FN3.2ClH/c16-12-4-2-1-3-11(12)10-5-6-13-14(9-10)19-15(18-13)7-8-17;;/h1-6,9H,7-8,17H2,(H,18,19);2*1H |
| InChIKey | PDXBMWMURCSMHK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |