C21H29N5O3 — CID 142691662
N-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide (PubChem CID 142691662) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide.
| Compound Name | N-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 142691662 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-4-[4-(hydroxyamino)-4-oxobutyl]piperidine-1-carboxamide |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(NC(=O)N2CCC(CCCC(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O3/c1-14-20(15(2)24-23-14)17-6-8-18(9-7-17)22-21(28)26-12-10-16(11-13-26)4-3-5-19(27)25-29/h6-9,16,29H,3-5,10-13H2,1-2H3,(H,22,28)(H,23,24)(H,25,27) |
| InChIKey | IRCBYFRDEYHLDX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|