C13H17F3N4O — CID 62967404
N-(4-aminophenyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (PubChem CID 62967404) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 62967404 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(4-aminophenyl)-4-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)N2CCN(CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C13H17F3N4O/c14-13(15,16)9-19-5-7-20(8-6-19)12(21)18-11-3-1-10(17)2-4-11/h1-4H,5-9,17H2,(H,18,21) |
| InChIKey | LECJJZPJJUTVDO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|