C13H18F3N3 — CID 144655800
4-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]benzene-1,4-diamine (PubChem CID 144655800) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 144655800 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NC2CCN(CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C13H18F3N3/c14-13(15,16)9-19-7-5-12(6-8-19)18-11-3-1-10(17)2-4-11/h1-4,12,18H,5-9,17H2 |
| InChIKey | UMIKFDLLZANODU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|