C11H15F3N2S — CID 66352549
N-thiophen-3-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 66352549) has the molecular formula C11H15F3N2S and a molecular weight of 264.32 g/mol. Its IUPAC name is N-thiophen-3-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-thiophen-3-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 66352549 |
| Molecular Formula | C11H15F3N2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-thiophen-3-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(Nc2ccsc2)CC1 |
| InChI | InChI=1S/C11H15F3N2S/c12-11(13,14)8-16-4-1-9(2-5-16)15-10-3-6-17-7-10/h3,6-7,9,15H,1-2,4-5,8H2 |
| InChIKey | RWTFMJLJEZAMCD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |