C14H18F3IN2 — CID 43785266
N-(4-iodo-2-methylphenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 43785266) has the molecular formula C14H18F3IN2 and a molecular weight of 398.21 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(4-iodo-2-methylphenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 43785266 |
| Molecular Formula | C14H18F3IN2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | Cc1cc(I)ccc1NC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F3IN2/c1-10-8-11(18)2-3-13(10)19-12-4-6-20(7-5-12)9-14(15,16)17/h2-3,8,12,19H,4-7,9H2,1H3 |
| InChIKey | CCFCDTXTOHDPJT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|