C13H14BrF5N2 — CID 107609894
N-(4-bromo-2,5-difluorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 107609894) has the molecular formula C13H14BrF5N2 and a molecular weight of 373.16 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107609894 |
| Molecular Formula | C13H14BrF5N2 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | Fc1cc(NC2CCN(CC(F)(F)F)CC2)c(F)cc1Br |
| InChI | InChI=1S/C13H14BrF5N2/c14-9-5-11(16)12(6-10(9)15)20-8-1-3-21(4-2-8)7-13(17,18)19/h5-6,8,20H,1-4,7H2 |
| InChIKey | SVGSSVXWVQWUSB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|