C26H34F2N4O3 — CID 69371869
9-(3-cyclopropyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-ethoxypyrimidin-5-yl)-5,5-difluorononanoic acid (PubChem CID 69371869) has the molecular formula C26H34F2N4O3 and a molecular weight of 488.58 g/mol. Its IUPAC name is 9-(3-cyclopropyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-ethoxypyrimidin-5-yl)-5,5-difluorononanoic acid.
| Compound Name | 9-(3-cyclopropyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-ethoxypyrimidin-5-yl)-5,5-difluorononanoic acid |
|---|---|
| PubChem CID | 69371869 |
| Molecular Formula | C26H34F2N4O3 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 9-(3-cyclopropyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-3-(2-ethoxypyrimidin-5-yl)-5,5-difluorononanoic acid |
| SMILES | CCOc1ncc(C(CC(=O)O)CC(F)(F)CCCCc2nc3c(cc2C2CC2)CCCN3)cn1 |
| InChI | InChI=1S/C26H34F2N4O3/c1-2-35-25-30-15-20(16-31-25)19(13-23(33)34)14-26(27,28)10-4-3-7-22-21(17-8-9-17)12-18-6-5-11-29-24(18)32-22/h12,15-17,19H,2-11,13-14H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | KGNYBJITJDELTM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|