C23H32F2N4O3 — CID 159921441
(3S)-5,5-difluoro-3-(4-methoxy-2H-pyrimidin-1-yl)-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 159921441) has the molecular formula C23H32F2N4O3 and a molecular weight of 450.53 g/mol. Its IUPAC name is (3S)-5,5-difluoro-3-(4-methoxy-2H-pyrimidin-1-yl)-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (3S)-5,5-difluoro-3-(4-methoxy-2H-pyrimidin-1-yl)-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 159921441 |
| Molecular Formula | C23H32F2N4O3 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (3S)-5,5-difluoro-3-(4-methoxy-2H-pyrimidin-1-yl)-9-(3-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | COC1=NCN([C@@H](CC(=O)O)CC(F)(F)CCCCc2nc3c(cc2C)CCCN3)C=C1 |
| InChI | InChI=1S/C23H32F2N4O3/c1-16-12-17-6-5-10-26-22(17)28-19(16)7-3-4-9-23(24,25)14-18(13-21(30)31)29-11-8-20(32-2)27-15-29/h8,11-12,18H,3-7,9-10,13-15H2,1-2H3,(H,26,28)(H,30,31)/t18-/m0/s1 |
| InChIKey | NYLHCUAKPXZQQK-SFHVURJKSA-N |
| XLogP | 4.16 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|